C40H48F4N8 — CID 157053814
3-(difluoromethyl)-1-methyl-N'-(11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyrazole-4-carboximidamide (PubChem CID 157053814) has the molecular formula C40H48F4N8 and a molecular weight of 716.87 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N'-(11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyrazole-4-carboximidamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N'-(11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 157053814 |
| Molecular Formula | C40H48F4N8 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.39 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N'-(11-propan-2-yl-3-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyrazole-4-carboximidamide |
| SMILES | CC(C)C1C2CCC1c1c(/N=C(\N)c3cn(C)nc3C(F)F)cccc12.CC(C)C1C2CCC1c1c(/N=C(\N)c3cn(C)nc3C(F)F)cccc12 |
| InChI | InChI=1S/2C20H24F2N4/c2*1-10(2)16-12-7-8-13(16)17-11(12)5-4-6-15(17)24-20(23)14-9-26(3)25-18(14)19(21)22/h2*4-6,9-10,12-13,16,19H,7-8H2,1-3H3,(H2,23,24) |
| InChIKey | AAMZXQMAJBWRAV-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|