C38H40O7S — CID 15705429
[(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethylsulfanyl-5-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] acetate (PubChem CID 15705429) has the molecular formula C38H40O7S and a molecular weight of 640.80 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethylsulfanyl-5-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethylsulfanyl-5-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 15705429 |
| Molecular Formula | C38H40O7S |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4-acetyloxy-6-ethylsulfanyl-5-phenylmethoxy-2-(trityloxymethyl)oxan-3-yl] acetate |
| SMILES | CCS[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H40O7S/c1-4-46-37-36(41-25-29-17-9-5-10-18-29)35(44-28(3)40)34(43-27(2)39)33(45-37)26-42-38(30-19-11-6-12-20-30,31-21-13-7-14-22-31)32-23-15-8-16-24-32/h5-24,33-37H,4,25-26H2,1-3H3/t33-,34-,35+,36-,37+/m1/s1 |
| InChIKey | GXGVFPOBPYHRCA-MANRWTMFSA-N |
| XLogP | 6.92 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|