C52H36BBrCl2N8O2 — CID 157054941
2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2-(3-chloro-5-pyridin-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine;pyridin-3-ylboronic acid (PubChem CID 157054941) has the molecular formula C52H36BBrCl2N8O2 and a molecular weight of 966.54 g/mol. Its IUPAC name is 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2-(3-chloro-5-pyridin-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine;pyridin-3-ylboronic acid.
| Compound Name | 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2-(3-chloro-5-pyridin-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine;pyridin-3-ylboronic acid |
|---|---|
| PubChem CID | 157054941 |
| Molecular Formula | C52H36BBrCl2N8O2 |
| Molecular Weight | 966.54 g/mol |
| Exact Mass | 964.16 |
| IUPAC Name | 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine;2-(3-chloro-5-pyridin-3-ylphenyl)-4,6-diphenyl-1,3,5-triazine;pyridin-3-ylboronic acid |
| SMILES | Clc1cc(-c2cccnc2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1.Clc1cc(Br)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1.OB(O)c1cccnc1 |
| InChI | InChI=1S/C26H17ClN4.C21H13BrClN3.C5H6BNO2/c27-23-15-21(20-12-7-13-28-17-20)14-22(16-23)26-30-24(18-8-3-1-4-9-18)29-25(31-26)19-10-5-2-6-11-19;22-17-11-16(12-18(23)13-17)21-25-19(14-7-3-1-4-8-14)24-20(26-21)15-9-5-2-6-10-15;8-6(9)5-2-1-3-7-4-5/h1-17H;1-13H;1-4,8-9H |
| InChIKey | AAQHLFOIDUFJAK-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.54 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|