About methane;1-methyliminopropan-2-one
methane;1-methyliminopropan-2-one (PubChem CID 157054980) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is methane;1-methyliminopropan-2-one.
Molecular Properties
| Compound Name | methane;1-methyliminopropan-2-one |
| PubChem CID | 157054980 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | methane;1-methyliminopropan-2-one |
| SMILES | C.C/N=C/C(C)=O |
| InChI | InChI=1S/C4H7NO.CH4/c1-4(6)3-5-2;/h3H,1-2H3;1H4/b5-3+; |
| InChIKey | AAQKPEKYJNWTGL-WGCWOXMQSA-N |
| XLogP | 0.91 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyliminopropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyliminopropan-2-one?
The IUPAC name of methane;1-methyliminopropan-2-one (CID 157054980) is methane;1-methyliminopropan-2-one.
What is the SMILES notation for methane;1-methyliminopropan-2-one?
The canonical SMILES for methane;1-methyliminopropan-2-one is C.C/N=C/C(C)=O.
What is the InChIKey of methane;1-methyliminopropan-2-one?
The InChIKey is AAQKPEKYJNWTGL-WGCWOXMQSA-N. The full InChI is InChI=1S/C4H7NO.CH4/c1-4(6)3-5-2;/h3H,1-2H3;1H4/b5-3+;.
What are the key properties of methane;1-methyliminopropan-2-one?
methane;1-methyliminopropan-2-one has a molecular weight of 101.15 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyliminopropan-2-one is sourced from PubChem (CID 157054980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).