About bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane
bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane (PubChem CID 157055029) has the molecular formula C14H36N4O6
and a molecular weight of 356.46 g/mol. Its IUPAC name is bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane.
Molecular Properties
| Compound Name | bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane |
| PubChem CID | 157055029 |
| Molecular Formula | C14H36N4O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane |
| SMILES | C.C.C.C.[C-]#[N+]N=C(OC)OC.[H]N=C(OC)OC.[H]N=C(OC)OC |
| InChI | InChI=1S/C4H6N2O2.2C3H7NO2.4CH4/c1-5-6-4(7-2)8-3;2*1-5-3(4)6-2;;;;/h2-3H3;2*4H,1-2H3;4*1H4 |
| InChIKey | AAQOFAYXQUMDRP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane?
The IUPAC name of bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane (CID 157055029) is bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane.
What is the SMILES notation for bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane?
The canonical SMILES for bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane is C.C.C.C.[C-]#[N+]N=C(OC)OC.[H]N=C(OC)OC.[H]N=C(OC)OC.
What is the InChIKey of bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane?
The InChIKey is AAQOFAYXQUMDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2.2C3H7NO2.4CH4/c1-5-6-4(7-2)8-3;2*1-5-3(4)6-2;;;;/h2-3H3;2*4H,1-2H3;4*1H4.
What are the key properties of bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane?
bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane has a molecular weight of 356.46 g/mol, XLogP of 3.44, 0 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethoxymethanimine);N-isocyano-1,1-dimethoxymethanimine;methane is sourced from PubChem (CID 157055029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).