C8H13NO4S — CID 15705520
[(1S,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] methanesulfonate (PubChem CID 15705520) has the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. Its IUPAC name is [(1S,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] methanesulfonate.
| Compound Name | [(1S,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 15705520 |
| Molecular Formula | C8H13NO4S |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | [(1S,8S)-5-oxo-1,2,3,6,7,8-hexahydropyrrolizin-1-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C8H13NO4S/c1-14(11,12)13-7-4-5-9-6(7)2-3-8(9)10/h6-7H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | KJIMANJRAFSBGT-BQBZGAKWSA-N |
| XLogP | -0.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|