C59H70BF4N2O8 — CID 157055906
CID 157055906 (PubChem CID 157055906) has the molecular formula C59H70BF4N2O8 and a molecular weight of 1022.02 g/mol.
| Compound Name | CID 157055906 |
|---|---|
| PubChem CID | 157055906 |
| Molecular Formula | C59H70BF4N2O8 |
| Molecular Weight | 1022.02 g/mol |
| Exact Mass | 1021.52 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O.CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1.[B] |
| InChI | InChI=1S/C33H41F2NO4.C26H29F2NO4.B/c1-21(2)29-20-28(22-8-12-24(34)13-9-22)31(23-10-14-25(35)15-11-23)36(29)17-16-26-18-27(39-33(6,7)38-26)19-30(37)40-32(3,4)5;1-16(2)24-15-23(17-3-7-19(27)8-4-17)26(18-5-9-20(28)10-6-18)29(24)12-11-21(30)13-22(31)14-25(32)33;/h8-15,20-21,26-27H,16-19H2,1-7H3;3-10,15-16,21-22,30-31H,11-14H2,1-2H3,(H,32,33);/t26-,27-;21-,22-;/m11./s1 |
| InChIKey | ZGPYPZNIFMYSRK-IVLLFVIXSA-N |
| XLogP | 13.08 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.02 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|