About CID 157055906
CID 157055906 (PubChem CID 157055906) has the molecular formula C59H70BF4N2O8
and a molecular weight of 1022.02 g/mol.
Molecular Properties
| Compound Name | CID 157055906 |
| PubChem CID | 157055906 |
| Molecular Formula | C59H70BF4N2O8 |
| Molecular Weight | 1022.02 g/mol |
| Exact Mass | 1021.52 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O.CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1.[B] |
| InChI | InChI=1S/C33H41F2NO4.C26H29F2NO4.B/c1-21(2)29-20-28(22-8-12-24(34)13-9-22)31(23-10-14-25(35)15-11-23)36(29)17-16-26-18-27(39-33(6,7)38-26)19-30(37)40-32(3,4)5;1-16(2)24-15-23(17-3-7-19(27)8-4-17)26(18-5-9-20(28)10-6-18)29(24)12-11-21(30)13-22(31)14-25(32)33;/h8-15,20-21,26-27H,16-19H2,1-7H3;3-10,15-16,21-22,30-31H,11-14H2,1-2H3,(H,32,33);/t26-,27-;21-,22-;/m11./s1 |
| InChIKey | ZGPYPZNIFMYSRK-IVLLFVIXSA-N |
| XLogP | 13.08 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1022.02 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157055906 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157055906?
The IUPAC name of CID 157055906 (CID 157055906) is not available.
What is the SMILES notation for CID 157055906?
The canonical SMILES for CID 157055906 is CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H](O)C[C@@H](O)CC(=O)O.CC(C)c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)n1CC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1.[B].
What is the InChIKey of CID 157055906?
The InChIKey is ZGPYPZNIFMYSRK-IVLLFVIXSA-N. The full InChI is InChI=1S/C33H41F2NO4.C26H29F2NO4.B/c1-21(2)29-20-28(22-8-12-24(34)13-9-22)31(23-10-14-25(35)15-11-23)36(29)17-16-26-18-27(39-33(6,7)38-26)19-30(37)40-32(3,4)5;1-16(2)24-15-23(17-3-7-19(27)8-4-17)26(18-5-9-20(28)10-6-18)29(24)12-11-21(30)13-22(31)14-25(32)33;/h8-15,20-21,26-27H,16-19H2,1-7H3;3-10,15-16,21-22,30-31H,11-14H2,1-2H3,(H,32,33);/t26-,27-;21-,22-;/m11./s1.
What are the key properties of CID 157055906?
CID 157055906 has a molecular weight of 1022.02 g/mol, XLogP of 13.08, 18 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157055906 is sourced from PubChem (CID 157055906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).