C50H62N6O — CID 157056408
N,N-diethyl-1-[(2-phenylquinolin-4-yl)methyl]piperidin-4-amine;N,N-diethylpiperidin-4-amine;2-phenylquinoline-4-carbaldehyde (PubChem CID 157056408) has the molecular formula C50H62N6O and a molecular weight of 763.09 g/mol. Its IUPAC name is N,N-diethyl-1-[(2-phenylquinolin-4-yl)methyl]piperidin-4-amine;N,N-diethylpiperidin-4-amine;2-phenylquinoline-4-carbaldehyde.
| Compound Name | N,N-diethyl-1-[(2-phenylquinolin-4-yl)methyl]piperidin-4-amine;N,N-diethylpiperidin-4-amine;2-phenylquinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 157056408 |
| Molecular Formula | C50H62N6O |
| Molecular Weight | 763.09 g/mol |
| Exact Mass | 762.50 |
| IUPAC Name | N,N-diethyl-1-[(2-phenylquinolin-4-yl)methyl]piperidin-4-amine;N,N-diethylpiperidin-4-amine;2-phenylquinoline-4-carbaldehyde |
| SMILES | CCN(CC)C1CCN(Cc2cc(-c3ccccc3)nc3ccccc23)CC1.CCN(CC)C1CCNCC1.O=Cc1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C25H31N3.C16H11NO.C9H20N2/c1-3-28(4-2)22-14-16-27(17-15-22)19-21-18-25(20-10-6-5-7-11-20)26-24-13-9-8-12-23(21)24;18-11-13-10-16(12-6-2-1-3-7-12)17-15-9-5-4-8-14(13)15;1-3-11(4-2)9-5-7-10-8-6-9/h5-13,18,22H,3-4,14-17,19H2,1-2H3;1-11H;9-10H,3-8H2,1-2H3 |
| InChIKey | AAUQWKQXEWQWMN-UHFFFAOYSA-N |
| XLogP | 10.00 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.09 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|