About 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole
5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole (PubChem CID 157057515) has the molecular formula C21H16Br2N6O2
and a molecular weight of 544.21 g/mol. Its IUPAC name is 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole.
Molecular Properties
| Compound Name | 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole |
| PubChem CID | 157057515 |
| Molecular Formula | C21H16Br2N6O2 |
| Molecular Weight | 544.21 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole |
| SMILES | Cn1ncc2cc(-c3ncc(Br)cc3[N+](=O)[O-])ccc21.Cn1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H9BrN4O2.C8H7BrN2/c1-17-11-3-2-8(4-9(11)6-16-17)13-12(18(19)20)5-10(14)7-15-13;1-11-8-3-2-7(9)4-6(8)5-10-11/h2-7H,1H3;2-5H,1H3 |
| InChIKey | AAXVXUQDZJPMNK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.21 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole?
The IUPAC name of 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole (CID 157057515) is 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole.
What is the SMILES notation for 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole?
The canonical SMILES for 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole is Cn1ncc2cc(-c3ncc(Br)cc3[N+](=O)[O-])ccc21.Cn1ncc2cc(Br)ccc21.
What is the InChIKey of 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole?
The InChIKey is AAXVXUQDZJPMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN4O2.C8H7BrN2/c1-17-11-3-2-8(4-9(11)6-16-17)13-12(18(19)20)5-10(14)7-15-13;1-11-8-3-2-7(9)4-6(8)5-10-11/h2-7H,1H3;2-5H,1H3.
What are the key properties of 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole?
5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole has a molecular weight of 544.21 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-methylindazole;5-(5-bromo-3-nitro-2-pyridinyl)-1-methylindazole is sourced from PubChem (CID 157057515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).