C10H20OS — CID 157058139
(3R,4S,5S,6S)-6-ethyl-3,4,5-trimethylthian-2-ol (PubChem CID 157058139) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is (3R,4S,5S,6S)-6-ethyl-3,4,5-trimethylthian-2-ol.
| Compound Name | (3R,4S,5S,6S)-6-ethyl-3,4,5-trimethylthian-2-ol |
|---|---|
| PubChem CID | 157058139 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (3R,4S,5S,6S)-6-ethyl-3,4,5-trimethylthian-2-ol |
| SMILES | CC[C@@H]1SC(O)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C10H20OS/c1-5-9-7(3)6(2)8(4)10(11)12-9/h6-11H,5H2,1-4H3/t6-,7-,8+,9-,10?/m0/s1 |
| InChIKey | AAZPSXGPQBPTLL-YZUYTKQYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |