C16H12O12P2+2 — CID 157058789
(2,3-dicarboxyphenyl)-hydroxy-oxophosphanium;(2,4-dicarboxyphenyl)-hydroxy-oxophosphanium (PubChem CID 157058789) has the molecular formula C16H12O12P2+2 and a molecular weight of 458.21 g/mol. Its IUPAC name is (2,3-dicarboxyphenyl)-hydroxy-oxophosphanium;(2,4-dicarboxyphenyl)-hydroxy-oxophosphanium.
| Compound Name | (2,3-dicarboxyphenyl)-hydroxy-oxophosphanium;(2,4-dicarboxyphenyl)-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 157058789 |
| Molecular Formula | C16H12O12P2+2 |
| Molecular Weight | 458.21 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | (2,3-dicarboxyphenyl)-hydroxy-oxophosphanium;(2,4-dicarboxyphenyl)-hydroxy-oxophosphanium |
| SMILES | O=C(O)c1ccc([P+](=O)O)c(C(=O)O)c1.O=C(O)c1cccc([P+](=O)O)c1C(=O)O |
| InChI | InChI=1S/2C8H5O6P/c9-7(10)4-1-2-6(15(13)14)5(3-4)8(11)12;9-7(10)4-2-1-3-5(15(13)14)6(4)8(11)12/h2*1-3H,(H2-,9,10,11,12,13,14)/p+2 |
| InChIKey | YAWAXGHOCOKDPW-UHFFFAOYSA-P |
| XLogP | 0.89 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|