About chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine
chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine (PubChem CID 157059554) has the molecular formula C15H25N5O2
and a molecular weight of 307.40 g/mol. Its IUPAC name is chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine.
Molecular Properties
| Compound Name | chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine |
| PubChem CID | 157059554 |
| Molecular Formula | C15H25N5O2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine |
| SMILES | CN.CNCCCN=C(N)N.O=c1ccc2ccccc2o1 |
| InChI | InChI=1S/C9H6O2.C5H14N4.CH5N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-8-3-2-4-9-5(6)7;1-2/h1-6H;8H,2-4H2,1H3,(H4,6,7,9);2H2,1H3 |
| InChIKey | ABDZDZBMZIOVDW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine?
The IUPAC name of chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine (CID 157059554) is chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine.
What is the SMILES notation for chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine?
The canonical SMILES for chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine is CN.CNCCCN=C(N)N.O=c1ccc2ccccc2o1.
What is the InChIKey of chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine?
The InChIKey is ABDZDZBMZIOVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.C5H14N4.CH5N/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-8-3-2-4-9-5(6)7;1-2/h1-6H;8H,2-4H2,1H3,(H4,6,7,9);2H2,1H3.
What are the key properties of chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine?
chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine has a molecular weight of 307.40 g/mol, XLogP of 0.24, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chromen-2-one;methanamine;2-[3-(methylamino)propyl]guanidine is sourced from PubChem (CID 157059554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).