C41H46N6O6S2 — CID 157060387
3-(benzenesulfonyl)-5-piperazin-1-yl-1H-indole;tert-butyl 4-[3-(benzenesulfonyl)-1H-indol-5-yl]piperazine-1-carboxylate (PubChem CID 157060387) has the molecular formula C41H46N6O6S2 and a molecular weight of 782.99 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-5-piperazin-1-yl-1H-indole;tert-butyl 4-[3-(benzenesulfonyl)-1H-indol-5-yl]piperazine-1-carboxylate.
| Compound Name | 3-(benzenesulfonyl)-5-piperazin-1-yl-1H-indole;tert-butyl 4-[3-(benzenesulfonyl)-1H-indol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 157060387 |
| Molecular Formula | C41H46N6O6S2 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.29 |
| IUPAC Name | 3-(benzenesulfonyl)-5-piperazin-1-yl-1H-indole;tert-butyl 4-[3-(benzenesulfonyl)-1H-indol-5-yl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3[nH]cc(S(=O)(=O)c4ccccc4)c3c2)CC1.O=S(=O)(c1ccccc1)c1c[nH]c2ccc(N3CCNCC3)cc12 |
| InChI | InChI=1S/C23H27N3O4S.C18H19N3O2S/c1-23(2,3)30-22(27)26-13-11-25(12-14-26)17-9-10-20-19(15-17)21(16-24-20)31(28,29)18-7-5-4-6-8-18;22-24(23,15-4-2-1-3-5-15)18-13-20-17-7-6-14(12-16(17)18)21-10-8-19-9-11-21/h4-10,15-16,24H,11-14H2,1-3H3;1-7,12-13,19-20H,8-11H2 |
| InChIKey | ABGOLIIIRWVDJJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 147.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_indol(1)', 'substructure': 'N/A'} |
|---|