About 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol
2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol (PubChem CID 157060513) has the molecular formula C12H8Br4N2O2
and a molecular weight of 531.82 g/mol. Its IUPAC name is 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol.
Molecular Properties
| Compound Name | 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol |
| PubChem CID | 157060513 |
| Molecular Formula | C12H8Br4N2O2 |
| Molecular Weight | 531.82 g/mol |
| Exact Mass | 527.73 |
| IUPAC Name | 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol |
| SMILES | O=Cc1cc(Br)ncc1Br.OCc1cc(Br)ncc1Br |
| InChI | InChI=1S/C6H5Br2NO.C6H3Br2NO/c2*7-5-2-9-6(8)1-4(5)3-10/h1-2,10H,3H2;1-3H |
| InChIKey | ABGXKXUOLMQBKW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol?
The IUPAC name of 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol (CID 157060513) is 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol.
What is the SMILES notation for 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol?
The canonical SMILES for 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol is O=Cc1cc(Br)ncc1Br.OCc1cc(Br)ncc1Br.
What is the InChIKey of 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol?
The InChIKey is ABGXKXUOLMQBKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2NO.C6H3Br2NO/c2*7-5-2-9-6(8)1-4(5)3-10/h1-2,10H,3H2;1-3H.
What are the key properties of 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol?
2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol has a molecular weight of 531.82 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromopyridine-4-carbaldehyde;(2,5-dibromo-4-pyridinyl)methanol is sourced from PubChem (CID 157060513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).