C21H16F6N3O4S2- — CID 157060733
4-[3-[3,5-bis(trifluoromethyl)phenoxy]-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine (PubChem CID 157060733) has the molecular formula C21H16F6N3O4S2- and a molecular weight of 552.50 g/mol. Its IUPAC name is 4-[3-[3,5-bis(trifluoromethyl)phenoxy]-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine.
| Compound Name | 4-[3-[3,5-bis(trifluoromethyl)phenoxy]-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 157060733 |
| Molecular Formula | C21H16F6N3O4S2- |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | 4-[3-[3,5-bis(trifluoromethyl)phenoxy]-2-oxopyrrolidin-1-yl]benzenesulfinate;1,3-thiazol-2-amine |
| SMILES | Nc1nccs1.O=C1C(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CCN1c1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C18H13F6NO4S.C3H4N2S/c19-17(20,21)10-7-11(18(22,23)24)9-13(8-10)29-15-5-6-25(16(15)26)12-1-3-14(4-2-12)30(27)28;4-3-5-1-2-6-3/h1-4,7-9,15H,5-6H2,(H,27,28);1-2H,(H2,4,5)/p-1 |
| InChIKey | WVEDUGZCSSLIQJ-UHFFFAOYSA-M |
| XLogP | 4.87 |
| TPSA | 108.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|