About CID 157061212
CID 157061212 (PubChem CID 157061212) has the molecular formula C38H41B2BrN6O2
and a molecular weight of 715.31 g/mol.
Molecular Properties
| Compound Name | CID 157061212 |
| PubChem CID | 157061212 |
| Molecular Formula | C38H41B2BrN6O2 |
| Molecular Weight | 715.31 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | — |
| SMILES | Cc1ncc(-c2ccccc2)c2cc(CN3CCN([B]C=O)CC3)ccc12.Cc1ncc(Br)c2cc(CN3CCN([B]C=O)CC3)ccc12 |
| InChI | InChI=1S/C22H23BN3O.C16H18BBrN3O/c1-17-20-8-7-18(15-25-9-11-26(12-10-25)23-16-27)13-21(20)22(14-24-17)19-5-3-2-4-6-19;1-12-14-3-2-13(8-15(14)16(18)9-19-12)10-20-4-6-21(7-5-20)17-11-22/h2-8,13-14,16H,9-12,15H2,1H3;2-3,8-9,11H,4-7,10H2,1H3 |
| InChIKey | YXERPWVOEYTWHR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 715.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 157061212 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157061212?
The IUPAC name of CID 157061212 (CID 157061212) is not available.
What is the SMILES notation for CID 157061212?
The canonical SMILES for CID 157061212 is Cc1ncc(-c2ccccc2)c2cc(CN3CCN([B]C=O)CC3)ccc12.Cc1ncc(Br)c2cc(CN3CCN([B]C=O)CC3)ccc12.
What is the InChIKey of CID 157061212?
The InChIKey is YXERPWVOEYTWHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BN3O.C16H18BBrN3O/c1-17-20-8-7-18(15-25-9-11-26(12-10-25)23-16-27)13-21(20)22(14-24-17)19-5-3-2-4-6-19;1-12-14-3-2-13(8-15(14)16(18)9-19-12)10-20-4-6-21(7-5-20)17-11-22/h2-8,13-14,16H,9-12,15H2,1H3;2-3,8-9,11H,4-7,10H2,1H3.
What are the key properties of CID 157061212?
CID 157061212 has a molecular weight of 715.31 g/mol, XLogP of 5.37, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157061212 is sourced from PubChem (CID 157061212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).