About cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile
cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile (PubChem CID 157062277) has the molecular formula C23H43N5O
and a molecular weight of 405.63 g/mol. Its IUPAC name is cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile.
Molecular Properties
| Compound Name | cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile |
| PubChem CID | 157062277 |
| Molecular Formula | C23H43N5O |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.35 |
| IUPAC Name | cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile |
| SMILES | CN1CCN(C2(C#N)CCCCC2)CC1.CN1CCNCC1.O=C1CCCCC1 |
| InChI | InChI=1S/C12H21N3.C6H10O.C5H12N2/c1-14-7-9-15(10-8-14)12(11-13)5-3-2-4-6-12;7-6-4-2-1-3-5-6;1-7-4-2-6-3-5-7/h2-10H2,1H3;1-5H2;6H,2-5H2,1H3 |
| InChIKey | ABLSWXWCBFAVJP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile?
The IUPAC name of cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile (CID 157062277) is cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile.
What is the SMILES notation for cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile?
The canonical SMILES for cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile is CN1CCN(C2(C#N)CCCCC2)CC1.CN1CCNCC1.O=C1CCCCC1.
What is the InChIKey of cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile?
The InChIKey is ABLSWXWCBFAVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3.C6H10O.C5H12N2/c1-14-7-9-15(10-8-14)12(11-13)5-3-2-4-6-12;7-6-4-2-1-3-5-6;1-7-4-2-6-3-5-7/h2-10H2,1H3;1-5H2;6H,2-5H2,1H3.
What are the key properties of cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile?
cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile has a molecular weight of 405.63 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanone;1-methylpiperazine;1-(4-methylpiperazin-1-yl)cyclohexane-1-carbonitrile is sourced from PubChem (CID 157062277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).