C30H20N6O2S — CID 157062973
1-diazohexa-1,2,3,4,5-pentaene;6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole;hepta-1,2,3,4,5,6-hexaene (PubChem CID 157062973) has the molecular formula C30H20N6O2S and a molecular weight of 528.60 g/mol. Its IUPAC name is 1-diazohexa-1,2,3,4,5-pentaene;6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole;hepta-1,2,3,4,5,6-hexaene.
| Compound Name | 1-diazohexa-1,2,3,4,5-pentaene;6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole;hepta-1,2,3,4,5,6-hexaene |
|---|---|
| PubChem CID | 157062973 |
| Molecular Formula | C30H20N6O2S |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 1-diazohexa-1,2,3,4,5-pentaene;6-(3,4-dimethoxyphenyl)-3-phenyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole;hepta-1,2,3,4,5,6-hexaene |
| SMILES | C=C=C=C=C=C=C.C=C=C=C=C=C=[N+]=[N-].COc1ccc(-c2nn3c(-c4ccccc4)nnc3s2)cc1OC |
| InChI | InChI=1S/C17H14N4O2S.C7H4.C6H2N2/c1-22-13-9-8-12(10-14(13)23-2)16-20-21-15(18-19-17(21)24-16)11-6-4-3-5-7-11;1-3-5-7-6-4-2;1-2-3-4-5-6-8-7/h3-10H,1-2H3;1-2H2;1H2 |
| InChIKey | ABNRCXMRLTZWDI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 97.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|