C40H40FN5O5 — CID 157063929
2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-yl)ethanone (PubChem CID 157063929) has the molecular formula C40H40FN5O5 and a molecular weight of 689.79 g/mol. Its IUPAC name is 2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-yl)ethanone.
| Compound Name | 2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-yl)ethanone |
|---|---|
| PubChem CID | 157063929 |
| Molecular Formula | C40H40FN5O5 |
| Molecular Weight | 689.79 g/mol |
| Exact Mass | 689.30 |
| IUPAC Name | 2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(3-phenyl-1,4,6-triazatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-5-yl)ethanone |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)c4nc(-c5ccccc5)c5c(n4)C4CCN5CC4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C40H40FN5O5/c1-48-35-24-29-31(25-36(35)50-19-5-14-45-17-20-49-21-18-45)42-13-10-33(29)51-34-9-8-26(22-30(34)41)23-32(47)40-43-37(27-6-3-2-4-7-27)39-38(44-40)28-11-15-46(39)16-12-28/h2-4,6-10,13,22,24-25,28H,5,11-12,14-21,23H2,1H3 |
| InChIKey | YGINTLMZUPTFSO-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 99.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.79 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|