C20H19NO7 — CID 157063999
methyl 2-(3-cyano-4-hydroxyphenyl)acetate;methyl 2-(3-formyl-4-hydroxyphenyl)acetate (PubChem CID 157063999) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is methyl 2-(3-cyano-4-hydroxyphenyl)acetate;methyl 2-(3-formyl-4-hydroxyphenyl)acetate.
| Compound Name | methyl 2-(3-cyano-4-hydroxyphenyl)acetate;methyl 2-(3-formyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 157063999 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl 2-(3-cyano-4-hydroxyphenyl)acetate;methyl 2-(3-formyl-4-hydroxyphenyl)acetate |
| SMILES | COC(=O)Cc1ccc(O)c(C#N)c1.COC(=O)Cc1ccc(O)c(C=O)c1 |
| InChI | InChI=1S/C10H9NO3.C10H10O4/c2*1-14-10(13)5-7-2-3-9(12)8(4-7)6-11/h2-4,12H,5H2,1H3;2-4,6,12H,5H2,1H3 |
| InChIKey | ABQUAXXEKTXPII-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 133.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|