C22H24N3O6PS — CID 157064247
[4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylmethyl-ethoxyphosphinic acid (PubChem CID 157064247) has the molecular formula C22H24N3O6PS and a molecular weight of 489.49 g/mol. Its IUPAC name is [4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylmethyl-ethoxyphosphinic acid.
| Compound Name | [4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylmethyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 157064247 |
| Molecular Formula | C22H24N3O6PS |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | [4-[2-[3-amino-6-(4-methylphenyl)pyrazin-2-yl]-2-oxoethyl]phenyl]sulfonylmethyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3ccc(C)cc3)cnc2N)cc1 |
| InChI | InChI=1S/C22H24N3O6PS/c1-3-31-32(27,28)14-33(29,30)18-10-6-16(7-11-18)12-20(26)21-22(23)24-13-19(25-21)17-8-4-15(2)5-9-17/h4-11,13H,3,12,14H2,1-2H3,(H2,23,24)(H,27,28) |
| InChIKey | CGBNACOVJWWKOT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 149.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|