C19H35FO3 — CID 157064255
(3S,4S,6R)-2-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane (PubChem CID 157064255) has the molecular formula C19H35FO3 and a molecular weight of 330.48 g/mol. Its IUPAC name is (3S,4S,6R)-2-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane.
| Compound Name | (3S,4S,6R)-2-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane |
|---|---|
| PubChem CID | 157064255 |
| Molecular Formula | C19H35FO3 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (3S,4S,6R)-2-ethyl-5-[(2S,4S,5S)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-6-fluoro-3,4-dimethyloxane |
| SMILES | CCC1O[C@@H](OC2[C@@H](C)[C@H](C)C(CC)O[C@@H]2F)C(C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C19H35FO3/c1-8-15-12(5)13(6)17(18(20)21-15)23-19-14(7)10(3)11(4)16(9-2)22-19/h10-19H,8-9H2,1-7H3/t10-,11-,12-,13-,14?,15?,16?,17?,18-,19-/m0/s1 |
| InChIKey | ABRNBERTAGWUNX-QHTVYDJCSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |