C25H50O — CID 157064714
1-tert-butylbicyclo[1.1.1]pentane;(1R,2R,5R)-2,5-dimethylcyclohexan-1-ol;2,2,3,3-tetramethylbutane (PubChem CID 157064714) has the molecular formula C25H50O and a molecular weight of 366.67 g/mol. Its IUPAC name is 1-tert-butylbicyclo[1.1.1]pentane;(1R,2R,5R)-2,5-dimethylcyclohexan-1-ol;2,2,3,3-tetramethylbutane.
| Compound Name | 1-tert-butylbicyclo[1.1.1]pentane;(1R,2R,5R)-2,5-dimethylcyclohexan-1-ol;2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 157064714 |
| Molecular Formula | C25H50O |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.39 |
| IUPAC Name | 1-tert-butylbicyclo[1.1.1]pentane;(1R,2R,5R)-2,5-dimethylcyclohexan-1-ol;2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C)C(C)(C)C.CC(C)(C)C12CC(C1)C2.C[C@@H]1CC[C@@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C9H16.C8H16O.C8H18/c1-8(2,3)9-4-7(5-9)6-9;1-6-3-4-7(2)8(9)5-6;1-7(2,3)8(4,5)6/h7H,4-6H2,1-3H3;6-9H,3-5H2,1-2H3;1-6H3/t;6-,7-,8-;/m.1./s1 |
| InChIKey | ABSXTOSCHDNSCU-HNKVXWHYSA-N |
| XLogP | 7.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |