About 3-phenyl-2H-1,2-oxazol-5-one
3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 157064774) has the molecular formula C18H14N2O4
and a molecular weight of 322.32 g/mol. Its IUPAC name is 3-phenyl-2H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 3-phenyl-2H-1,2-oxazol-5-one |
| PubChem CID | 157064774 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | O=c1cc(-c2ccccc2)[nH]o1.O=c1cc(-c2ccccc2)[nH]o1 |
| InChI | InChI=1S/2C9H7NO2/c2*11-9-6-8(10-12-9)7-4-2-1-3-5-7/h2*1-6,10H |
| InChIKey | ABTCUVCTPLGFBA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-2H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2H-1,2-oxazol-5-one?
The IUPAC name of 3-phenyl-2H-1,2-oxazol-5-one (CID 157064774) is 3-phenyl-2H-1,2-oxazol-5-one.
What is the SMILES notation for 3-phenyl-2H-1,2-oxazol-5-one?
The canonical SMILES for 3-phenyl-2H-1,2-oxazol-5-one is O=c1cc(-c2ccccc2)[nH]o1.O=c1cc(-c2ccccc2)[nH]o1.
What is the InChIKey of 3-phenyl-2H-1,2-oxazol-5-one?
The InChIKey is ABTCUVCTPLGFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO2/c2*11-9-6-8(10-12-9)7-4-2-1-3-5-7/h2*1-6,10H.
What are the key properties of 3-phenyl-2H-1,2-oxazol-5-one?
3-phenyl-2H-1,2-oxazol-5-one has a molecular weight of 322.32 g/mol, XLogP of 3.27, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2H-1,2-oxazol-5-one is sourced from PubChem (CID 157064774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).