C10H12N2O — CID 157066045
4,7-dimethyl-3-methylidenepyrido[3,2-b][1,4]oxazine (PubChem CID 157066045) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 4,7-dimethyl-3-methylidenepyrido[3,2-b][1,4]oxazine.
| Compound Name | 4,7-dimethyl-3-methylidenepyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 157066045 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4,7-dimethyl-3-methylidenepyrido[3,2-b][1,4]oxazine |
| SMILES | C=C1COc2cc(C)cnc2N1C |
| InChI | InChI=1S/C10H12N2O/c1-7-4-9-10(11-5-7)12(3)8(2)6-13-9/h4-5H,2,6H2,1,3H3 |
| InChIKey | XJQKEMZSNSXDNC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |