About 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol
1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol (PubChem CID 157067849) has the molecular formula C13H20N6O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol |
| PubChem CID | 157067849 |
| Molecular Formula | C13H20N6O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol |
| SMILES | CO.Nc1ccn(C2CC2)n1.O=[N+]([O-])c1ccn(C2CC2)n1 |
| InChI | InChI=1S/C6H7N3O2.C6H9N3.CH4O/c10-9(11)6-3-4-8(7-6)5-1-2-5;7-6-3-4-9(8-6)5-1-2-5;1-2/h3-5H,1-2H2;3-5H,1-2H2,(H2,7,8);2H,1H3 |
| InChIKey | ACBWFUNOSOUTDJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol?
The IUPAC name of 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol (CID 157067849) is 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol.
What is the SMILES notation for 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol?
The canonical SMILES for 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol is CO.Nc1ccn(C2CC2)n1.O=[N+]([O-])c1ccn(C2CC2)n1.
What is the InChIKey of 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol?
The InChIKey is ACBWFUNOSOUTDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2.C6H9N3.CH4O/c10-9(11)6-3-4-8(7-6)5-1-2-5;7-6-3-4-9(8-6)5-1-2-5;1-2/h3-5H,1-2H2;3-5H,1-2H2,(H2,7,8);2H,1H3.
What are the key properties of 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol?
1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol has a molecular weight of 308.34 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-nitropyrazole;1-cyclopropylpyrazol-3-amine;methanol is sourced from PubChem (CID 157067849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).