C23H37N3O7 — CID 157067876
(1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-(1-methoxycyclopentyl)-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione;methane (PubChem CID 157067876) has the molecular formula C23H37N3O7 and a molecular weight of 467.56 g/mol. Its IUPAC name is (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-(1-methoxycyclopentyl)-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione;methane.
| Compound Name | (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-(1-methoxycyclopentyl)-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione;methane |
|---|---|
| PubChem CID | 157067876 |
| Molecular Formula | C23H37N3O7 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-(1-methoxycyclopentyl)-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione;methane |
| SMILES | C.COC(CN1C[C@@H]2[C@H]3CCC[C@@H](C(=O)N2CC1=O)N3C(=O)C(=O)C1(OC)CCCC1)OC |
| InChI | InChI=1S/C22H33N3O7.CH4/c1-30-18(31-2)13-23-11-16-14-7-6-8-15(20(28)24(16)12-17(23)26)25(14)21(29)19(27)22(32-3)9-4-5-10-22;/h14-16,18H,4-13H2,1-3H3;1H4/t14-,15+,16-;/m1./s1 |
| InChIKey | ACBYJBWQQSETLI-GBEOHXTHSA-N |
| XLogP | 0.57 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|