About (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene
(1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene (PubChem CID 15706911) has the molecular formula C13H12N4O8
and a molecular weight of 352.26 g/mol. Its IUPAC name is (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene.
Molecular Properties
| Compound Name | (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene |
| PubChem CID | 15706911 |
| Molecular Formula | C13H12N4O8 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene |
| SMILES | C[C@@]1([N+](=O)[O-])C=C[C@@](C)(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C13H12N4O8/c1-11(13(15(20)21,16(22)23)17(24)25)7-8-12(2,14(18)19)10-6-4-3-5-9(10)11/h3-8H,1-2H3/t11-,12-/m1/s1 |
| InChIKey | RCKNNHBVTDEODV-VXGBXAGGSA-N |
| XLogP | 1.49 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene?
The IUPAC name of (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene (CID 15706911) is (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene.
What is the SMILES notation for (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene?
The canonical SMILES for (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene is C[C@@]1([N+](=O)[O-])C=C[C@@](C)(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])c2ccccc21.
What is the InChIKey of (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene?
The InChIKey is RCKNNHBVTDEODV-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H12N4O8/c1-11(13(15(20)21,16(22)23)17(24)25)7-8-12(2,14(18)19)10-6-4-3-5-9(10)11/h3-8H,1-2H3/t11-,12-/m1/s1.
What are the key properties of (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene?
(1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene has a molecular weight of 352.26 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1,4-dimethyl-1-nitro-4-(trinitromethyl)naphthalene is sourced from PubChem (CID 15706911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).