About 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate
4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate (PubChem CID 157069618) has the molecular formula C20H22Br2F2O2
and a molecular weight of 492.20 g/mol. Its IUPAC name is 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate.
Molecular Properties
| Compound Name | 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate |
| PubChem CID | 157069618 |
| Molecular Formula | C20H22Br2F2O2 |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 490.00 |
| IUPAC Name | 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate |
| SMILES | C=Cc1cc(Br)ccc1F.CCOC(C)=O.CCc1cc(Br)ccc1F |
| InChI | InChI=1S/C8H8BrF.C8H6BrF.C4H8O2/c2*1-2-6-5-7(9)3-4-8(6)10;1-3-6-4(2)5/h3-5H,2H2,1H3;2-5H,1H2;3H2,1-2H3 |
| InChIKey | ACGSPEAMOLWDDJ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate?
The IUPAC name of 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate (CID 157069618) is 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate.
What is the SMILES notation for 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate?
The canonical SMILES for 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate is C=Cc1cc(Br)ccc1F.CCOC(C)=O.CCc1cc(Br)ccc1F.
What is the InChIKey of 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate?
The InChIKey is ACGSPEAMOLWDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF.C8H6BrF.C4H8O2/c2*1-2-6-5-7(9)3-4-8(6)10;1-3-6-4(2)5/h3-5H,2H2,1H3;2-5H,1H2;3H2,1-2H3.
What are the key properties of 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate?
4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate has a molecular weight of 492.20 g/mol, XLogP of 6.95, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethenyl-1-fluorobenzene;4-bromo-2-ethyl-1-fluorobenzene;ethyl acetate is sourced from PubChem (CID 157069618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).