C20H21BF3NO3 — CID 157069648
1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 157069648) has the molecular formula C20H21BF3NO3 and a molecular weight of 391.20 g/mol. Its IUPAC name is 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 157069648 |
| Molecular Formula | C20H21BF3NO3 |
| Molecular Weight | 391.20 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-[6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | CC1(C)OB(c2cccc(C(=O)Cc3ccc(C(F)(F)F)nc3)c2)OC1(C)C |
| InChI | InChI=1S/C20H21BF3NO3/c1-18(2)19(3,4)28-21(27-18)15-7-5-6-14(11-15)16(26)10-13-8-9-17(25-12-13)20(22,23)24/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | ACGWBCUOWHNBIO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.20 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|