C33H40Cl3N9O8Si2 — CID 157069931
5-chloro-4-nitro-1H-indazole;2-[(5-chloro-4-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-chloro-4-nitroindazol-2-yl)methoxy]ethyl-trimethylsilane (PubChem CID 157069931) has the molecular formula C33H40Cl3N9O8Si2 and a molecular weight of 853.27 g/mol. Its IUPAC name is 5-chloro-4-nitro-1H-indazole;2-[(5-chloro-4-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-chloro-4-nitroindazol-2-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 5-chloro-4-nitro-1H-indazole;2-[(5-chloro-4-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-chloro-4-nitroindazol-2-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157069931 |
| Molecular Formula | C33H40Cl3N9O8Si2 |
| Molecular Weight | 853.27 g/mol |
| Exact Mass | 851.16 |
| IUPAC Name | 5-chloro-4-nitro-1H-indazole;2-[(5-chloro-4-nitroindazol-1-yl)methoxy]ethyl-trimethylsilane;2-[(5-chloro-4-nitroindazol-2-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc2c([N+](=O)[O-])c(Cl)ccc2n1.C[Si](C)(C)CCOCn1ncc2c([N+](=O)[O-])c(Cl)ccc21.O=[N+]([O-])c1c(Cl)ccc2[nH]ncc12 |
| InChI | InChI=1S/2C13H18ClN3O3Si.C7H4ClN3O2/c1-21(2,3)7-6-20-9-16-8-10-12(15-16)5-4-11(14)13(10)17(18)19;1-21(2,3)7-6-20-9-16-12-5-4-11(14)13(17(18)19)10(12)8-15-16;8-5-1-2-6-4(3-9-10-6)7(5)11(12)13/h2*4-5,8H,6-7,9H2,1-3H3;1-3H,(H,9,10) |
| InChIKey | ACHPVFJYLASJIS-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 212.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.27 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|