About 1,2,4-trichlorobutane
1,2,4-trichlorobutane (PubChem CID 15707) has the molecular formula C4H7Cl3
and a molecular weight of 161.46 g/mol. Its IUPAC name is 1,2,4-trichlorobutane.
Molecular Properties
| Compound Name | 1,2,4-trichlorobutane |
| PubChem CID | 15707 |
| Molecular Formula | C4H7Cl3 |
| Molecular Weight | 161.46 g/mol |
| Exact Mass | 159.96 |
| IUPAC Name | 1,2,4-trichlorobutane |
| SMILES | ClCCC(Cl)CCl |
| InChI | InChI=1S/C4H7Cl3/c5-2-1-4(7)3-6/h4H,1-3H2 |
| InChIKey | PIQHRAXKAGNHCM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-trichlorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trichlorobutane?
The IUPAC name of 1,2,4-trichlorobutane (CID 15707) is 1,2,4-trichlorobutane.
What is the SMILES notation for 1,2,4-trichlorobutane?
The canonical SMILES for 1,2,4-trichlorobutane is ClCCC(Cl)CCl.
What is the InChIKey of 1,2,4-trichlorobutane?
The InChIKey is PIQHRAXKAGNHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7Cl3/c5-2-1-4(7)3-6/h4H,1-3H2.
What are the key properties of 1,2,4-trichlorobutane?
1,2,4-trichlorobutane has a molecular weight of 161.46 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trichlorobutane is sourced from PubChem (CID 15707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).