C10H11ClFN3 — CID 157070146
[5-(3-fluorophenyl)-1H-imidazol-2-yl]methanamine;hydrochloride (PubChem CID 157070146) has the molecular formula C10H11ClFN3 and a molecular weight of 227.67 g/mol. Its IUPAC name is [5-(3-fluorophenyl)-1H-imidazol-2-yl]methanamine;hydrochloride.
| Compound Name | [5-(3-fluorophenyl)-1H-imidazol-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 157070146 |
| Molecular Formula | C10H11ClFN3 |
| Molecular Weight | 227.67 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | [5-(3-fluorophenyl)-1H-imidazol-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCc1ncc(-c2cccc(F)c2)[nH]1 |
| InChI | InChI=1S/C10H10FN3.ClH/c11-8-3-1-2-7(4-8)9-6-13-10(5-12)14-9;/h1-4,6H,5,12H2,(H,13,14);1H |
| InChIKey | KLLQJUJGBAMQTH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |