C47H44N2O14S2 — CID 157071232
2-[(4-ethoxyphenyl)carbamoyl]-5-(4-methylphenyl)peroxysulfanyloxybenzoic acid;5-(4-methylphenoxy)-2-[(4-propan-2-yloxyphenyl)carbamoyl]benzoic acid;sulfur dioxide (PubChem CID 157071232) has the molecular formula C47H44N2O14S2 and a molecular weight of 925.00 g/mol. Its IUPAC name is 2-[(4-ethoxyphenyl)carbamoyl]-5-(4-methylphenyl)peroxysulfanyloxybenzoic acid;5-(4-methylphenoxy)-2-[(4-propan-2-yloxyphenyl)carbamoyl]benzoic acid;sulfur dioxide.
| Compound Name | 2-[(4-ethoxyphenyl)carbamoyl]-5-(4-methylphenyl)peroxysulfanyloxybenzoic acid;5-(4-methylphenoxy)-2-[(4-propan-2-yloxyphenyl)carbamoyl]benzoic acid;sulfur dioxide |
|---|---|
| PubChem CID | 157071232 |
| Molecular Formula | C47H44N2O14S2 |
| Molecular Weight | 925.00 g/mol |
| Exact Mass | 924.22 |
| IUPAC Name | 2-[(4-ethoxyphenyl)carbamoyl]-5-(4-methylphenyl)peroxysulfanyloxybenzoic acid;5-(4-methylphenoxy)-2-[(4-propan-2-yloxyphenyl)carbamoyl]benzoic acid;sulfur dioxide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(OSOOc3ccc(C)cc3)cc2C(=O)O)cc1.Cc1ccc(Oc2ccc(C(=O)Nc3ccc(OC(C)C)cc3)c(C(=O)O)c2)cc1.O=S=O |
| InChI | InChI=1S/C24H23NO5.C23H21NO7S.O2S/c1-15(2)29-18-10-6-17(7-11-18)25-23(26)21-13-12-20(14-22(21)24(27)28)30-19-8-4-16(3)5-9-19;1-3-28-17-10-6-16(7-11-17)24-22(25)20-13-12-19(14-21(20)23(26)27)30-32-31-29-18-8-4-15(2)5-9-18;1-3-2/h4-15H,1-3H3,(H,25,26)(H,27,28);4-14H,3H2,1-2H3,(H,24,25)(H,26,27); |
| InChIKey | ACLMSOBYSKIOKP-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 222.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.00 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|