C36H37FN8O2 — CID 157072105
1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one (PubChem CID 157072105) has the molecular formula C36H37FN8O2 and a molecular weight of 632.74 g/mol. Its IUPAC name is 1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 157072105 |
| Molecular Formula | C36H37FN8O2 |
| Molecular Weight | 632.74 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 1-[3-[3-(3-fluoro-4-morpholin-4-ylanilino)-6-(3-piperidin-1-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-4-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(-c2nc(Nc3cccc(N4CCCCC4)c3)nc3n[nH]c(Nc4ccc(N5CCOCC5)c(F)c4)c23)c1 |
| InChI | InChI=1S/C36H37FN8O2/c1-2-29(46)21-24-8-6-9-25(20-24)33-32-34(38-27-12-13-31(30(37)23-27)45-16-18-47-19-17-45)42-43-35(32)41-36(40-33)39-26-10-7-11-28(22-26)44-14-4-3-5-15-44/h2,6-13,20,22-23H,1,3-5,14-19,21H2,(H3,38,39,40,41,42,43) |
| InChIKey | ZXVZWXYFJMKWAK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.74 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|