C10H15NO5S2 — CID 15707348
4-(4-hydroxybutylsulfonyl)benzenesulfonamide (PubChem CID 15707348) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-(4-hydroxybutylsulfonyl)benzenesulfonamide.
| Compound Name | 4-(4-hydroxybutylsulfonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 15707348 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-(4-hydroxybutylsulfonyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)CCCCO)cc1 |
| InChI | InChI=1S/C10H15NO5S2/c11-18(15,16)10-5-3-9(4-6-10)17(13,14)8-2-1-7-12/h3-6,12H,1-2,7-8H2,(H2,11,15,16) |
| InChIKey | HLBQGOCNVGPIOX-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|