C23H18N2O3 — CID 157073784
benzyl N-[5-[2-(3H-inden-5-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate (PubChem CID 157073784) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is benzyl N-[5-[2-(3H-inden-5-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate.
| Compound Name | benzyl N-[5-[2-(3H-inden-5-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
|---|---|
| PubChem CID | 157073784 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | benzyl N-[5-[2-(3H-inden-5-yl)ethynyl]-3-methyl-1,2-oxazol-4-yl]carbamate |
| SMILES | Cc1noc(C#Cc2ccc3c(c2)CC=C3)c1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H18N2O3/c1-16-22(24-23(26)27-15-18-6-3-2-4-7-18)21(28-25-16)13-11-17-10-12-19-8-5-9-20(19)14-17/h2-8,10,12,14H,9,15H2,1H3,(H,24,26) |
| InChIKey | KLLDFOOWAMPOMQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|