About 3-ethyl-1,2,4-trimethylpyrrole
3-ethyl-1,2,4-trimethylpyrrole (PubChem CID 15707387) has the molecular formula C9H15N
and a molecular weight of 137.23 g/mol. Its IUPAC name is 3-ethyl-1,2,4-trimethylpyrrole.
Molecular Properties
| Compound Name | 3-ethyl-1,2,4-trimethylpyrrole |
| PubChem CID | 15707387 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3-ethyl-1,2,4-trimethylpyrrole |
| SMILES | CCc1c(C)cn(C)c1C |
| InChI | InChI=1S/C9H15N/c1-5-9-7(2)6-10(4)8(9)3/h6H,5H2,1-4H3 |
| InChIKey | GNDJZIVQGWPAKS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,2,4-trimethylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2,4-trimethylpyrrole?
The IUPAC name of 3-ethyl-1,2,4-trimethylpyrrole (CID 15707387) is 3-ethyl-1,2,4-trimethylpyrrole.
What is the SMILES notation for 3-ethyl-1,2,4-trimethylpyrrole?
The canonical SMILES for 3-ethyl-1,2,4-trimethylpyrrole is CCc1c(C)cn(C)c1C.
What is the InChIKey of 3-ethyl-1,2,4-trimethylpyrrole?
The InChIKey is GNDJZIVQGWPAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-5-9-7(2)6-10(4)8(9)3/h6H,5H2,1-4H3.
What are the key properties of 3-ethyl-1,2,4-trimethylpyrrole?
3-ethyl-1,2,4-trimethylpyrrole has a molecular weight of 137.23 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2,4-trimethylpyrrole is sourced from PubChem (CID 15707387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).