C28H45BN2O6 — CID 157076439
tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate;2-cyclopropyloxy-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 157076439) has the molecular formula C28H45BN2O6 and a molecular weight of 516.49 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate;2-cyclopropyloxy-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate;2-cyclopropyloxy-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 157076439 |
| Molecular Formula | C28H45BN2O6 |
| Molecular Weight | 516.49 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-oxopiperidine-1-carboxylate;2-cyclopropyloxy-5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1(C)C.Cc1cc(N)c(OC2CC2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H24BNO3.C12H21NO3/c1-10-8-13(18)14(19-11-6-7-11)9-12(10)17-20-15(2,3)16(4,5)21-17;1-11(2,3)16-10(15)13-7-6-9(14)8-12(13,4)5/h8-9,11H,6-7,18H2,1-5H3;6-8H2,1-5H3 |
| InChIKey | ADAIBLCKKIGUHC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|