C15H22FN5O3 — CID 157076906
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol;hydrofluoride (PubChem CID 157076906) has the molecular formula C15H22FN5O3 and a molecular weight of 339.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol;hydrofluoride.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol;hydrofluoride |
|---|---|
| PubChem CID | 157076906 |
| Molecular Formula | C15H22FN5O3 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-(hydroxymethyl)-5-[(E)-3-methylbut-1-enyl]oxolan-3-ol;hydrofluoride |
| SMILES | CC(C)/C=C/[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1CO.F |
| InChI | InChI=1S/C15H21N5O3.FH/c1-8(2)3-4-10-9(5-21)12(22)15(23-10)20-7-19-11-13(16)17-6-18-14(11)20;/h3-4,6-10,12,15,21-22H,5H2,1-2H3,(H2,16,17,18);1H/b4-3+;/t9-,10-,12-,15-;/m1./s1 |
| InChIKey | ADBOZNKESSRPSG-NNSPEMEZSA-N |
| XLogP | 0.64 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|