C18H16F5N5O — CID 157078316
3-(3-fluoro-3-methylcyclobutyl)-6-[5-fluoro-6-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 157078316) has the molecular formula C18H16F5N5O and a molecular weight of 413.35 g/mol. Its IUPAC name is 3-(3-fluoro-3-methylcyclobutyl)-6-[5-fluoro-6-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(3-fluoro-3-methylcyclobutyl)-6-[5-fluoro-6-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 157078316 |
| Molecular Formula | C18H16F5N5O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-(3-fluoro-3-methylcyclobutyl)-6-[5-fluoro-6-[(2R)-1,1,1-trifluoropropan-2-yl]oxy-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C[C@@H](Oc1ncc(-c2cn3c(C4CC(C)(F)C4)nnc3cn2)cc1F)C(F)(F)F |
| InChI | InChI=1S/C18H16F5N5O/c1-9(18(21,22)23)29-16-12(19)3-10(6-25-16)13-8-28-14(7-24-13)26-27-15(28)11-4-17(2,20)5-11/h3,6-9,11H,4-5H2,1-2H3/t9-,11?,17?/m1/s1 |
| InChIKey | LCOAKQOKIGEJQO-WVTWZTMVSA-N |
| XLogP | 4.26 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |