C33H22Cl2F2N2O2 — CID 157078864
5-chloro-2-(3-fluorophenyl)quinoline-3-carbaldehyde;1-[5-chloro-2-(3-fluorophenyl)quinolin-3-yl]ethanol (PubChem CID 157078864) has the molecular formula C33H22Cl2F2N2O2 and a molecular weight of 587.45 g/mol. Its IUPAC name is 5-chloro-2-(3-fluorophenyl)quinoline-3-carbaldehyde;1-[5-chloro-2-(3-fluorophenyl)quinolin-3-yl]ethanol.
| Compound Name | 5-chloro-2-(3-fluorophenyl)quinoline-3-carbaldehyde;1-[5-chloro-2-(3-fluorophenyl)quinolin-3-yl]ethanol |
|---|---|
| PubChem CID | 157078864 |
| Molecular Formula | C33H22Cl2F2N2O2 |
| Molecular Weight | 587.45 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | 5-chloro-2-(3-fluorophenyl)quinoline-3-carbaldehyde;1-[5-chloro-2-(3-fluorophenyl)quinolin-3-yl]ethanol |
| SMILES | CC(O)c1cc2c(Cl)cccc2nc1-c1cccc(F)c1.O=Cc1cc2c(Cl)cccc2nc1-c1cccc(F)c1 |
| InChI | InChI=1S/C17H13ClFNO.C16H9ClFNO/c1-10(21)13-9-14-15(18)6-3-7-16(14)20-17(13)11-4-2-5-12(19)8-11;17-14-5-2-6-15-13(14)8-11(9-20)16(19-15)10-3-1-4-12(18)7-10/h2-10,21H,1H3;1-9H |
| InChIKey | ADHHQFBVBWLQSK-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.45 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|