C21H25BClNO4 — CID 157078869
(2R,3S)-5-chloro-2-ethyl-2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-3-ol (PubChem CID 157078869) has the molecular formula C21H25BClNO4 and a molecular weight of 401.70 g/mol. Its IUPAC name is (2R,3S)-5-chloro-2-ethyl-2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-3-ol.
| Compound Name | (2R,3S)-5-chloro-2-ethyl-2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 157078869 |
| Molecular Formula | C21H25BClNO4 |
| Molecular Weight | 401.70 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2R,3S)-5-chloro-2-ethyl-2-pyridin-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-1-benzofuran-3-ol |
| SMILES | CC[C@]1(c2ccccn2)Oc2ccc(Cl)c(B3OC(C)(C)C(C)(C)O3)c2[C@@H]1O |
| InChI | InChI=1S/C21H25BClNO4/c1-6-21(15-9-7-8-12-24-15)18(25)16-14(26-21)11-10-13(23)17(16)22-27-19(2,3)20(4,5)28-22/h7-12,18,25H,6H2,1-5H3/t18-,21+/m0/s1 |
| InChIKey | OBEQAKIJVLZXIA-GHTZIAJQSA-N |
| XLogP | 3.77 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.70 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|