About 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate
2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate (PubChem CID 157079959) has the molecular formula C20H20ClN3O3S
and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate.
Molecular Properties
| Compound Name | 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate |
| PubChem CID | 157079959 |
| Molecular Formula | C20H20ClN3O3S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate |
| SMILES | CN(CCOC(=O)Nc1ccc2ncsc2c1)C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C20H20ClN3O3S/c1-24(19(25)9-6-14-4-2-3-5-16(14)21)10-11-27-20(26)23-15-7-8-17-18(12-15)28-13-22-17/h2-5,7-8,12-13H,6,9-11H2,1H3,(H,23,26) |
| InChIKey | ADKPSBRXTYODDR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate?
The IUPAC name of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate (CID 157079959) is 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate.
What is the SMILES notation for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate?
The canonical SMILES for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate is CN(CCOC(=O)Nc1ccc2ncsc2c1)C(=O)CCc1ccccc1Cl.
What is the InChIKey of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate?
The InChIKey is ADKPSBRXTYODDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClN3O3S/c1-24(19(25)9-6-14-4-2-3-5-16(14)21)10-11-27-20(26)23-15-7-8-17-18(12-15)28-13-22-17/h2-5,7-8,12-13H,6,9-11H2,1H3,(H,23,26).
What are the key properties of 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate?
2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate has a molecular weight of 417.92 g/mol, XLogP of 4.59, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-chlorophenyl)propanoyl-methylamino]ethyl N-(1,3-benzothiazol-6-yl)carbamate is sourced from PubChem (CID 157079959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).