About 2,6-dichloroimidazo[2,1-b][1,3]thiazole
2,6-dichloroimidazo[2,1-b][1,3]thiazole (PubChem CID 15708041) has the molecular formula C5H2Cl2N2S
and a molecular weight of 193.06 g/mol. Its IUPAC name is 2,6-dichloroimidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 2,6-dichloroimidazo[2,1-b][1,3]thiazole |
| PubChem CID | 15708041 |
| Molecular Formula | C5H2Cl2N2S |
| Molecular Weight | 193.06 g/mol |
| Exact Mass | 191.93 |
| IUPAC Name | 2,6-dichloroimidazo[2,1-b][1,3]thiazole |
| SMILES | Clc1cn2cc(Cl)sc2n1 |
| InChI | InChI=1S/C5H2Cl2N2S/c6-3-1-9-2-4(7)10-5(9)8-3/h1-2H |
| InChIKey | PHGWIAWEBQAWJE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.06 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-dichloroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 2,6-dichloroimidazo[2,1-b][1,3]thiazole (CID 15708041) is 2,6-dichloroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 2,6-dichloroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 2,6-dichloroimidazo[2,1-b][1,3]thiazole is Clc1cn2cc(Cl)sc2n1.
What is the InChIKey of 2,6-dichloroimidazo[2,1-b][1,3]thiazole?
The InChIKey is PHGWIAWEBQAWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Cl2N2S/c6-3-1-9-2-4(7)10-5(9)8-3/h1-2H.
What are the key properties of 2,6-dichloroimidazo[2,1-b][1,3]thiazole?
2,6-dichloroimidazo[2,1-b][1,3]thiazole has a molecular weight of 193.06 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 15708041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).