C14H22O4 — CID 157080729
methyl (E)-3-[(2S,3S,5S)-3-hydroxy-5-(3-methylbutyl)-4-methylideneoxolan-2-yl]prop-2-enoate (PubChem CID 157080729) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (E)-3-[(2S,3S,5S)-3-hydroxy-5-(3-methylbutyl)-4-methylideneoxolan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,3S,5S)-3-hydroxy-5-(3-methylbutyl)-4-methylideneoxolan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 157080729 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl (E)-3-[(2S,3S,5S)-3-hydroxy-5-(3-methylbutyl)-4-methylideneoxolan-2-yl]prop-2-enoate |
| SMILES | C=C1[C@H](CCC(C)C)O[C@@H](/C=C/C(=O)OC)[C@H]1O |
| InChI | InChI=1S/C14H22O4/c1-9(2)5-6-11-10(3)14(16)12(18-11)7-8-13(15)17-4/h7-9,11-12,14,16H,3,5-6H2,1-2,4H3/b8-7+/t11-,12-,14-/m0/s1 |
| InChIKey | XODNBZORMRHSFQ-UOCMLVICSA-N |
| XLogP | 1.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|