C15H26N4O3 — CID 157083062
bis(1,2,3,4-tetramethylimidazol-1-ium);carbonate (PubChem CID 157083062) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is bis(1,2,3,4-tetramethylimidazol-1-ium);carbonate.
| Compound Name | bis(1,2,3,4-tetramethylimidazol-1-ium);carbonate |
|---|---|
| PubChem CID | 157083062 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | bis(1,2,3,4-tetramethylimidazol-1-ium);carbonate |
| SMILES | Cc1c[n+](C)c(C)n1C.Cc1c[n+](C)c(C)n1C.O=C([O-])[O-] |
| InChI | InChI=1S/2C7H13N2.CH2O3/c2*1-6-5-8(3)7(2)9(6)4;2-1(3)4/h2*5H,1-4H3;(H2,2,3,4)/q2*+1;/p-2 |
| InChIKey | ADTSXZXQQDIVGE-UHFFFAOYSA-L |
| XLogP | -1.51 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|