C23H18FN5O — CID 157084336
1-[4-(3-amino-[1,2,4]triazolo[4,3-a]pyridin-5-yl)phenyl]-3-(6-fluoro-2-isocyano-3-methylphenyl)propan-2-one (PubChem CID 157084336) has the molecular formula C23H18FN5O and a molecular weight of 399.43 g/mol. Its IUPAC name is 1-[4-(3-amino-[1,2,4]triazolo[4,3-a]pyridin-5-yl)phenyl]-3-(6-fluoro-2-isocyano-3-methylphenyl)propan-2-one.
| Compound Name | 1-[4-(3-amino-[1,2,4]triazolo[4,3-a]pyridin-5-yl)phenyl]-3-(6-fluoro-2-isocyano-3-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 157084336 |
| Molecular Formula | C23H18FN5O |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 1-[4-(3-amino-[1,2,4]triazolo[4,3-a]pyridin-5-yl)phenyl]-3-(6-fluoro-2-isocyano-3-methylphenyl)propan-2-one |
| SMILES | [C-]#[N+]c1c(C)ccc(F)c1CC(=O)Cc1ccc(-c2cccc3nnc(N)n23)cc1 |
| InChI | InChI=1S/C23H18FN5O/c1-14-6-11-19(24)18(22(14)26-2)13-17(30)12-15-7-9-16(10-8-15)20-4-3-5-21-27-28-23(25)29(20)21/h3-11H,12-13H2,1H3,(H2,25,28) |
| InChIKey | ITJMWMAZMIIZIR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|