magnesium;hydrogen borate;phosphoric acid

H4BMgO7P — CID 157086965

IUPACmagnesium;hydrogen borate;phosphoric acid
SMILESO=P(O)(O)O.[Mg+2].[O-]B([O-])O
InChIInChI=1S/BHO3.Mg.H3O4P/c2-1(3)4;;1-5(2,3)4/h2H;;(H3,1,2,3,4)/q-2;+2;
InChIKeyAEEWLIZKFNYFHY-UHFFFAOYSA-N
MW182.12 g/mol
LogP-4.63
Rot. Bonds

About magnesium;hydrogen borate;phosphoric acid

magnesium;hydrogen borate;phosphoric acid (PubChem CID 157086965) has the molecular formula H4BMgO7P and a molecular weight of 182.12 g/mol. Its IUPAC name is magnesium;hydrogen borate;phosphoric acid.

Molecular Properties

Compound Namemagnesium;hydrogen borate;phosphoric acid
PubChem CID157086965
Molecular FormulaH4BMgO7P
Molecular Weight182.12 g/mol
Exact Mass181.96
IUPAC Namemagnesium;hydrogen borate;phosphoric acid
SMILESO=P(O)(O)O.[Mg+2].[O-]B([O-])O
InChIInChI=1S/BHO3.Mg.H3O4P/c2-1(3)4;;1-5(2,3)4/h2H;;(H3,1,2,3,4)/q-2;+2;
InChIKeyAEEWLIZKFNYFHY-UHFFFAOYSA-N
XLogP-4.63
TPSA144.11 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.12
LogP ≤ 5-4.63
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze magnesium;hydrogen borate;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of magnesium;hydrogen borate;phosphoric acid?
The IUPAC name of magnesium;hydrogen borate;phosphoric acid (CID 157086965) is magnesium;hydrogen borate;phosphoric acid.
What is the SMILES notation for magnesium;hydrogen borate;phosphoric acid?
The canonical SMILES for magnesium;hydrogen borate;phosphoric acid is O=P(O)(O)O.[Mg+2].[O-]B([O-])O.
What is the InChIKey of magnesium;hydrogen borate;phosphoric acid?
The InChIKey is AEEWLIZKFNYFHY-UHFFFAOYSA-N. The full InChI is InChI=1S/BHO3.Mg.H3O4P/c2-1(3)4;;1-5(2,3)4/h2H;;(H3,1,2,3,4)/q-2;+2;.
What are the key properties of magnesium;hydrogen borate;phosphoric acid?
magnesium;hydrogen borate;phosphoric acid has a molecular weight of 182.12 g/mol, XLogP of -4.63, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydrogen borate;phosphoric acid is sourced from PubChem (CID 157086965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).