About CID 157087920
CID 157087920 (PubChem CID 157087920) has the molecular formula C72H49AlBIN9O3P
and a molecular weight of 1285.92 g/mol.
Molecular Properties
| Compound Name | CID 157087920 |
| PubChem CID | 157087920 |
| Molecular Formula | C72H49AlBIN9O3P |
| Molecular Weight | 1285.92 g/mol |
| Exact Mass | 1285.27 |
| IUPAC Name | — |
| SMILES | [3H]P([B])I.c1ccc(-n2c(-c3cc(-c4nc5ccccc5n4-c4ccccc4)cc(-c4nc5ccccc5n4-c4ccccc4)c3)nc3ccccc32)cc1.c1cnc2c(O[Al](Oc3cccc4cccnc34)Oc3cccc4cccnc34)cccc2c1 |
| InChI | InChI=1S/C45H30N6.3C9H7NO.Al.BHIP/c1-4-16-34(17-5-1)49-40-25-13-10-22-37(40)46-43(49)31-28-32(44-47-38-23-11-14-26-41(38)50(44)35-18-6-2-7-19-35)30-33(29-31)45-48-39-24-12-15-27-42(39)51(45)36-20-8-3-9-21-36;3*11-8-5-1-3-7-4-2-6-10-9(7)8;;1-3-2/h1-30H;3*1-6,11H;;3H/q;;;;+3;/p-3/i;;;;;3T |
| InChIKey | GTSCCMJCWBHOSY-BLKXIALDSA-K |
| XLogP | 17.66 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1285.92 |
| LogP ≤ 5 | 17.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 157087920 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157087920?
The IUPAC name of CID 157087920 (CID 157087920) is not available.
What is the SMILES notation for CID 157087920?
The canonical SMILES for CID 157087920 is [3H]P([B])I.c1ccc(-n2c(-c3cc(-c4nc5ccccc5n4-c4ccccc4)cc(-c4nc5ccccc5n4-c4ccccc4)c3)nc3ccccc32)cc1.c1cnc2c(O[Al](Oc3cccc4cccnc34)Oc3cccc4cccnc34)cccc2c1.
What is the InChIKey of CID 157087920?
The InChIKey is GTSCCMJCWBHOSY-BLKXIALDSA-K. The full InChI is InChI=1S/C45H30N6.3C9H7NO.Al.BHIP/c1-4-16-34(17-5-1)49-40-25-13-10-22-37(40)46-43(49)31-28-32(44-47-38-23-11-14-26-41(38)50(44)35-18-6-2-7-19-35)30-33(29-31)45-48-39-24-12-15-27-42(39)51(45)36-20-8-3-9-21-36;3*11-8-5-1-3-7-4-2-6-10-9(7)8;;1-3-2/h1-30H;3*1-6,11H;;3H/q;;;;+3;/p-3/i;;;;;3T.
What are the key properties of CID 157087920?
CID 157087920 has a molecular weight of 1285.92 g/mol, XLogP of 17.66, 12 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157087920 is sourced from PubChem (CID 157087920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).